Description
Product details
| Product name | S-Adenosyl-L-methionine Disulfate Tosylate |
| CAS No. | 97540-22-2 |
| Appearance | White or almost white powder |
| Purity ( HPLC ) | 98.0% to105.0% |
| Heavy metals | Not more than 10 ppm |
| Loss on drying | Not more than 1% |
| Shelf life | 24 months |
| Packing | 25kg/drum or customized |
| Storage condition | Store in cool place away from sunlight |
| Quality | Refined |
| Trademark | GSHWORLD |
| HS Code | 29349990 |
| Formula | C15h22n6o5s2(H2so4)C7h8so3 |
| Specification | 99% |
| Origin | China |
| Production Capacity | 900tons/Year |
| Molecular Weight | 766.79 |
| Customization | Available |
S-Adenosyl-L-methionine functions
1. S-Adenosyl-L-methionine is a good nutrition for the liver,can prevent alcohol, drugs and the liver-cell injury;
2. S-Adenosyl-L-methionine has remarkable preventive effects on chronic active hepatitis, and other factors caused liver injury,heart disease, cancer and so on.
3. S-Adenosyl-L-methionine has been found to be as effective as pharmaceutical treatments for arthritis and major depression as well.
What is S-Adenosyl-L-methionine?
1. S-Adenosyl-L-methionine (SAMe) is a coenzyme involved in methyl group transfers. It is made from adenosine triphosphate (ATP) and methionine by methionine adenosyltransferase (EC 2.5.1.6). Transmethylation, transsulfuration, and aminopropylation are the metabolic pathways that use SAMe. Although these anabolic reactions occur throughout the body, most SAMe produced and consumed in the liver.
2. The methyl group (CH3) attached to the methionine sulfur atom in SAMe is chemically reactive. This allows donation of this group to an acceptor substrate in transmethylation reactions. More than 40 metabolic reactions involve the transfer of a methyl group from SAMe to various substrates such as nucleic acids, proteins, and lipids.
3. In bacteria, SAMe bound by the SAMe riboswitch, which regulates genes involved in methionine or cysteine biosynthesis.
4. TGY Provide S-Adenosylmethionine required for cellular growth and repair. Its also involved in the biosynthesis of several hormones and neurotransmitters that affect mood, such as dopamine and serotonin. Methyltransferases are also responsible for the addition of methyl groups to the 2′ hydroxyls of the first and second nucleotides next to the 5′ cap in messenger RNA
5. In the United States, S-Adenosylmethionine sold as a nutritional supplement under the marketing name SAMe-e (also spelled SAMe or SAMee). Some research has indicated that taking SAMe on a regular basis help fight depression, liver disease, and the pain of osteoarthritis. Multiple clinical trials indicate benefits for depression, some liver conditions and osteoarthritis. All other indications not yet proven.
